About 3-ethyl-2H-1,3-thiazole-4-carboxamide
3-ethyl-2H-1,3-thiazole-4-carboxamide (PubChem CID 174764354) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 3-ethyl-2H-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-2H-1,3-thiazole-4-carboxamide |
| PubChem CID | 174764354 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 3-ethyl-2H-1,3-thiazole-4-carboxamide |
| SMILES | CCN1CSC=C1C(N)=O |
| InChI | InChI=1S/C6H10N2OS/c1-2-8-4-10-3-5(8)6(7)9/h3H,2,4H2,1H3,(H2,7,9) |
| InChIKey | PJBKEXTXJICAOY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-2H-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-1,3-thiazole-4-carboxamide?
The IUPAC name of 3-ethyl-2H-1,3-thiazole-4-carboxamide (CID 174764354) is 3-ethyl-2H-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 3-ethyl-2H-1,3-thiazole-4-carboxamide?
The canonical SMILES for 3-ethyl-2H-1,3-thiazole-4-carboxamide is CCN1CSC=C1C(N)=O.
What is the InChIKey of 3-ethyl-2H-1,3-thiazole-4-carboxamide?
The InChIKey is PJBKEXTXJICAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-2-8-4-10-3-5(8)6(7)9/h3H,2,4H2,1H3,(H2,7,9).
What are the key properties of 3-ethyl-2H-1,3-thiazole-4-carboxamide?
3-ethyl-2H-1,3-thiazole-4-carboxamide has a molecular weight of 158.23 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 174764354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).