About 2-benzhydrylideneoxirane
2-benzhydrylideneoxirane (PubChem CID 174764540) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-benzhydrylideneoxirane.
Molecular Properties
| Compound Name | 2-benzhydrylideneoxirane |
| PubChem CID | 174764540 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-benzhydrylideneoxirane |
| SMILES | c1ccc(C(=C2CO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12O/c1-3-7-12(8-4-1)15(14-11-16-14)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | ZXICVKKBXWSXOI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydrylideneoxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydrylideneoxirane?
The IUPAC name of 2-benzhydrylideneoxirane (CID 174764540) is 2-benzhydrylideneoxirane.
What is the SMILES notation for 2-benzhydrylideneoxirane?
The canonical SMILES for 2-benzhydrylideneoxirane is c1ccc(C(=C2CO2)c2ccccc2)cc1.
What is the InChIKey of 2-benzhydrylideneoxirane?
The InChIKey is ZXICVKKBXWSXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c1-3-7-12(8-4-1)15(14-11-16-14)13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of 2-benzhydrylideneoxirane?
2-benzhydrylideneoxirane has a molecular weight of 208.26 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydrylideneoxirane is sourced from PubChem (CID 174764540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).