C24H18Cl3F3N4O2 — CID 174764793
5-(4-chlorophenyl)-2-[[5-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-3H-1,2,4-triazole-3-carbaldehyde (PubChem CID 174764793) has the molecular formula C24H18Cl3F3N4O2 and a molecular weight of 557.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[5-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-3H-1,2,4-triazole-3-carbaldehyde.
| Compound Name | 5-(4-chlorophenyl)-2-[[5-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-3H-1,2,4-triazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174764793 |
| Molecular Formula | C24H18Cl3F3N4O2 |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[5-(2,3-dichlorophenyl)-3-pyridinyl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-3H-1,2,4-triazole-3-carbaldehyde |
| SMILES | O=CC1N(Cc2cncc(-c3cccc(Cl)c3Cl)c2)N=C(c2ccc(Cl)cc2)N1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C24H18Cl3F3N4O2/c25-17-6-4-15(5-7-17)23-32-34(21(13-35)33(23)12-20(36)24(28,29)30)11-14-8-16(10-31-9-14)18-2-1-3-19(26)22(18)27/h1-10,13,20-21,36H,11-12H2/t20-,21?/m0/s1 |
| InChIKey | RHTQSTZWLGBFCE-BGERDNNASA-N |
| XLogP | 5.64 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|