About 2-ethynyl-3,6-dimethylaniline;formonitrile
2-ethynyl-3,6-dimethylaniline;formonitrile (PubChem CID 174764870) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-ethynyl-3,6-dimethylaniline;formonitrile.
Molecular Properties
| Compound Name | 2-ethynyl-3,6-dimethylaniline;formonitrile |
| PubChem CID | 174764870 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-ethynyl-3,6-dimethylaniline;formonitrile |
| SMILES | C#Cc1c(C)ccc(C)c1N.C#N |
| InChI | InChI=1S/C10H11N.CHN/c1-4-9-7(2)5-6-8(3)10(9)11;1-2/h1,5-6H,11H2,2-3H3;1H |
| InChIKey | MKUNOXSBAVUMJC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-3,6-dimethylaniline;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-3,6-dimethylaniline;formonitrile?
The IUPAC name of 2-ethynyl-3,6-dimethylaniline;formonitrile (CID 174764870) is 2-ethynyl-3,6-dimethylaniline;formonitrile.
What is the SMILES notation for 2-ethynyl-3,6-dimethylaniline;formonitrile?
The canonical SMILES for 2-ethynyl-3,6-dimethylaniline;formonitrile is C#Cc1c(C)ccc(C)c1N.C#N.
What is the InChIKey of 2-ethynyl-3,6-dimethylaniline;formonitrile?
The InChIKey is MKUNOXSBAVUMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.CHN/c1-4-9-7(2)5-6-8(3)10(9)11;1-2/h1,5-6H,11H2,2-3H3;1H.
What are the key properties of 2-ethynyl-3,6-dimethylaniline;formonitrile?
2-ethynyl-3,6-dimethylaniline;formonitrile has a molecular weight of 172.23 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-3,6-dimethylaniline;formonitrile is sourced from PubChem (CID 174764870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).