About ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one
ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one (PubChem CID 174765688) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one.
Molecular Properties
| Compound Name | ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one |
| PubChem CID | 174765688 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one |
| SMILES | C=C=O.O=c1[nH]ccn1CCO |
| InChI | InChI=1S/C5H8N2O2.C2H2O/c8-4-3-7-2-1-6-5(7)9;1-2-3/h1-2,8H,3-4H2,(H,6,9);1H2 |
| InChIKey | DPSAUDKPVCFQNX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one?
The IUPAC name of ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one (CID 174765688) is ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one.
What is the SMILES notation for ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one?
The canonical SMILES for ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one is C=C=O.O=c1[nH]ccn1CCO.
What is the InChIKey of ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one?
The InChIKey is DPSAUDKPVCFQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2.C2H2O/c8-4-3-7-2-1-6-5(7)9;1-2-3/h1-2,8H,3-4H2,(H,6,9);1H2.
What are the key properties of ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one?
ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one has a molecular weight of 170.17 g/mol, XLogP of -0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenone;3-(2-hydroxyethyl)-1H-imidazol-2-one is sourced from PubChem (CID 174765688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).