About N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide
N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide (PubChem CID 174765925) has the molecular formula C18H11Cl2N5O3
and a molecular weight of 416.22 g/mol. Its IUPAC name is N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide.
Molecular Properties
| Compound Name | N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide |
| PubChem CID | 174765925 |
| Molecular Formula | C18H11Cl2N5O3 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide |
| SMILES | O=CNc1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H11Cl2N5O3/c19-10-4-5-12(20)13(7-10)25-17-14(22-18(25)28)16(21-8-26)23-15(24-17)9-2-1-3-11(27)6-9/h1-8,27H,(H,22,28)(H,21,23,24,26) |
| InChIKey | MJYXKVULGVKMRL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide?
The IUPAC name of N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide (CID 174765925) is N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide.
What is the SMILES notation for N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide?
The canonical SMILES for N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide is O=CNc1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1cc(Cl)ccc1Cl.
What is the InChIKey of N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide?
The InChIKey is MJYXKVULGVKMRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2N5O3/c19-10-4-5-12(20)13(7-10)25-17-14(22-18(25)28)16(21-8-26)23-15(24-17)9-2-1-3-11(27)6-9/h1-8,27H,(H,22,28)(H,21,23,24,26).
What are the key properties of N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide?
N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide has a molecular weight of 416.22 g/mol, XLogP of 3.36, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-(2,5-dichlorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purin-6-yl]formamide is sourced from PubChem (CID 174765925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).