About 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane
6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane (PubChem CID 174766137) has the molecular formula C14H26OSi
and a molecular weight of 238.45 g/mol. Its IUPAC name is 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane.
Molecular Properties
| Compound Name | 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane |
| PubChem CID | 174766137 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane |
| SMILES | CCC1(C2CC=CCC2)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C14H26OSi/c1-4-14(13-9-6-5-7-10-13)11-8-12-16(2,3)15-14/h5-6,13H,4,7-12H2,1-3H3 |
| InChIKey | YBBNJZDUXMRDIF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane?
The IUPAC name of 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane (CID 174766137) is 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane.
What is the SMILES notation for 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane?
The canonical SMILES for 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane is CCC1(C2CC=CCC2)CCC[Si](C)(C)O1.
What is the InChIKey of 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane?
The InChIKey is YBBNJZDUXMRDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26OSi/c1-4-14(13-9-6-5-7-10-13)11-8-12-16(2,3)15-14/h5-6,13H,4,7-12H2,1-3H3.
What are the key properties of 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane?
6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane has a molecular weight of 238.45 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohex-3-en-1-yl-6-ethyl-2,2-dimethyloxasilinane is sourced from PubChem (CID 174766137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).