About (5-thiophen-3-yl-1,2-oxazol-3-yl) formate
(5-thiophen-3-yl-1,2-oxazol-3-yl) formate (PubChem CID 174766364) has the molecular formula C8H5NO3S
and a molecular weight of 195.20 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,2-oxazol-3-yl) formate.
Molecular Properties
| Compound Name | (5-thiophen-3-yl-1,2-oxazol-3-yl) formate |
| PubChem CID | 174766364 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | (5-thiophen-3-yl-1,2-oxazol-3-yl) formate |
| SMILES | O=COc1cc(-c2ccsc2)on1 |
| InChI | InChI=1S/C8H5NO3S/c10-5-11-8-3-7(12-9-8)6-1-2-13-4-6/h1-5H |
| InChIKey | GGTUMNQKHVECTO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-thiophen-3-yl-1,2-oxazol-3-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-3-yl-1,2-oxazol-3-yl) formate?
The IUPAC name of (5-thiophen-3-yl-1,2-oxazol-3-yl) formate (CID 174766364) is (5-thiophen-3-yl-1,2-oxazol-3-yl) formate.
What is the SMILES notation for (5-thiophen-3-yl-1,2-oxazol-3-yl) formate?
The canonical SMILES for (5-thiophen-3-yl-1,2-oxazol-3-yl) formate is O=COc1cc(-c2ccsc2)on1.
What is the InChIKey of (5-thiophen-3-yl-1,2-oxazol-3-yl) formate?
The InChIKey is GGTUMNQKHVECTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3S/c10-5-11-8-3-7(12-9-8)6-1-2-13-4-6/h1-5H.
What are the key properties of (5-thiophen-3-yl-1,2-oxazol-3-yl) formate?
(5-thiophen-3-yl-1,2-oxazol-3-yl) formate has a molecular weight of 195.20 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-3-yl-1,2-oxazol-3-yl) formate is sourced from PubChem (CID 174766364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).