About N'-amino-N-(2,2-difluoroethyl)acetohydrazide
N'-amino-N-(2,2-difluoroethyl)acetohydrazide (PubChem CID 174766431) has the molecular formula C4H9F2N3O
and a molecular weight of 153.13 g/mol. Its IUPAC name is N'-amino-N-(2,2-difluoroethyl)acetohydrazide.
Molecular Properties
| Compound Name | N'-amino-N-(2,2-difluoroethyl)acetohydrazide |
| PubChem CID | 174766431 |
| Molecular Formula | C4H9F2N3O |
| Molecular Weight | 153.13 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | N'-amino-N-(2,2-difluoroethyl)acetohydrazide |
| SMILES | CC(=O)N(CC(F)F)NN |
| InChI | InChI=1S/C4H9F2N3O/c1-3(10)9(8-7)2-4(5)6/h4,8H,2,7H2,1H3 |
| InChIKey | VANTZSGTSJRAGJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.13 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-N-(2,2-difluoroethyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-N-(2,2-difluoroethyl)acetohydrazide?
The IUPAC name of N'-amino-N-(2,2-difluoroethyl)acetohydrazide (CID 174766431) is N'-amino-N-(2,2-difluoroethyl)acetohydrazide.
What is the SMILES notation for N'-amino-N-(2,2-difluoroethyl)acetohydrazide?
The canonical SMILES for N'-amino-N-(2,2-difluoroethyl)acetohydrazide is CC(=O)N(CC(F)F)NN.
What is the InChIKey of N'-amino-N-(2,2-difluoroethyl)acetohydrazide?
The InChIKey is VANTZSGTSJRAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2N3O/c1-3(10)9(8-7)2-4(5)6/h4,8H,2,7H2,1H3.
What are the key properties of N'-amino-N-(2,2-difluoroethyl)acetohydrazide?
N'-amino-N-(2,2-difluoroethyl)acetohydrazide has a molecular weight of 153.13 g/mol, XLogP of -0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-N-(2,2-difluoroethyl)acetohydrazide is sourced from PubChem (CID 174766431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).