C19H19N — CID 174766755
1,2,3,4-tetrahydrochrysen-4-ylmethanamine (PubChem CID 174766755) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochrysen-4-ylmethanamine.
| Compound Name | 1,2,3,4-tetrahydrochrysen-4-ylmethanamine |
|---|---|
| PubChem CID | 174766755 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1,2,3,4-tetrahydrochrysen-4-ylmethanamine |
| SMILES | NCC1CCCc2ccc3c(ccc4ccccc43)c21 |
| InChI | InChI=1S/C19H19N/c20-12-15-6-3-5-14-9-10-17-16-7-2-1-4-13(16)8-11-18(17)19(14)15/h1-2,4,7-11,15H,3,5-6,12,20H2 |
| InChIKey | WSPYLUOOMNNWSQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|