About 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid
6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid (PubChem CID 174766841) has the molecular formula C17H28O7
and a molecular weight of 344.40 g/mol. Its IUPAC name is 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid.
Molecular Properties
| Compound Name | 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid |
| PubChem CID | 174766841 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid |
| SMILES | C=C(C)C(=O)OC(C(O)COC(=O)CCCCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H28O7/c1-11(2)16(22)24-15(17(3,4)5)12(18)10-23-14(21)9-7-6-8-13(19)20/h12,15,18H,1,6-10H2,2-5H3,(H,19,20) |
| InChIKey | BHFDXXGBVYLDBP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid?
The IUPAC name of 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid (CID 174766841) is 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid.
What is the SMILES notation for 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid?
The canonical SMILES for 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid is C=C(C)C(=O)OC(C(O)COC(=O)CCCCC(=O)O)C(C)(C)C.
What is the InChIKey of 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid?
The InChIKey is BHFDXXGBVYLDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O7/c1-11(2)16(22)24-15(17(3,4)5)12(18)10-23-14(21)9-7-6-8-13(19)20/h12,15,18H,1,6-10H2,2-5H3,(H,19,20).
What are the key properties of 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid?
6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid has a molecular weight of 344.40 g/mol, XLogP of 2.07, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-hydroxy-4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentoxy]-6-oxohexanoic acid is sourced from PubChem (CID 174766841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).