About (2,6-difluorophenyl) nitrite
(2,6-difluorophenyl) nitrite (PubChem CID 174766918) has the molecular formula C6H3F2NO2
and a molecular weight of 159.09 g/mol. Its IUPAC name is (2,6-difluorophenyl) nitrite.
Molecular Properties
| Compound Name | (2,6-difluorophenyl) nitrite |
| PubChem CID | 174766918 |
| Molecular Formula | C6H3F2NO2 |
| Molecular Weight | 159.09 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | (2,6-difluorophenyl) nitrite |
| SMILES | O=NOc1c(F)cccc1F |
| InChI | InChI=1S/C6H3F2NO2/c7-4-2-1-3-5(8)6(4)11-9-10/h1-3H |
| InChIKey | DKTDFRYFCIBZOL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,6-difluorophenyl) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl) nitrite?
The IUPAC name of (2,6-difluorophenyl) nitrite (CID 174766918) is (2,6-difluorophenyl) nitrite.
What is the SMILES notation for (2,6-difluorophenyl) nitrite?
The canonical SMILES for (2,6-difluorophenyl) nitrite is O=NOc1c(F)cccc1F.
What is the InChIKey of (2,6-difluorophenyl) nitrite?
The InChIKey is DKTDFRYFCIBZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2NO2/c7-4-2-1-3-5(8)6(4)11-9-10/h1-3H.
What are the key properties of (2,6-difluorophenyl) nitrite?
(2,6-difluorophenyl) nitrite has a molecular weight of 159.09 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl) nitrite is sourced from PubChem (CID 174766918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).