About potassium;permanganic acid;nitrite
potassium;permanganic acid;nitrite (PubChem CID 174767191) has the molecular formula HKMnNO6
and a molecular weight of 205.04 g/mol. Its IUPAC name is potassium;permanganic acid;nitrite.
Molecular Properties
| Compound Name | potassium;permanganic acid;nitrite |
| PubChem CID | 174767191 |
| Molecular Formula | HKMnNO6 |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 204.88 |
| IUPAC Name | potassium;permanganic acid;nitrite |
| SMILES | O=N[O-].O=[Mn](=O)(=O)O.[K+] |
| InChI | InChI=1S/K.Mn.HNO2.H2O.3O/c;;2-1-3;;;;/h;;(H,2,3);1H2;;;/q2*+1;;;;;/p-2 |
| InChIKey | ZYFDDGXSNBHMBK-UHFFFAOYSA-L |
| XLogP | -3.66 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;permanganic acid;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;permanganic acid;nitrite?
The IUPAC name of potassium;permanganic acid;nitrite (CID 174767191) is potassium;permanganic acid;nitrite.
What is the SMILES notation for potassium;permanganic acid;nitrite?
The canonical SMILES for potassium;permanganic acid;nitrite is O=N[O-].O=[Mn](=O)(=O)O.[K+].
What is the InChIKey of potassium;permanganic acid;nitrite?
The InChIKey is ZYFDDGXSNBHMBK-UHFFFAOYSA-L. The full InChI is InChI=1S/K.Mn.HNO2.H2O.3O/c;;2-1-3;;;;/h;;(H,2,3);1H2;;;/q2*+1;;;;;/p-2.
What are the key properties of potassium;permanganic acid;nitrite?
potassium;permanganic acid;nitrite has a molecular weight of 205.04 g/mol, XLogP of -3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;permanganic acid;nitrite is sourced from PubChem (CID 174767191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).