C21H27N3O — CID 174767399
9-(2-piperidin-1-ylethyl)-5,6,7,8-tetrahydroacridine-3-carboxamide (PubChem CID 174767399) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 9-(2-piperidin-1-ylethyl)-5,6,7,8-tetrahydroacridine-3-carboxamide.
| Compound Name | 9-(2-piperidin-1-ylethyl)-5,6,7,8-tetrahydroacridine-3-carboxamide |
|---|---|
| PubChem CID | 174767399 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 9-(2-piperidin-1-ylethyl)-5,6,7,8-tetrahydroacridine-3-carboxamide |
| SMILES | NC(=O)c1ccc2c(CCN3CCCCC3)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C21H27N3O/c22-21(25)15-8-9-18-16(10-13-24-11-4-1-5-12-24)17-6-2-3-7-19(17)23-20(18)14-15/h8-9,14H,1-7,10-13H2,(H2,22,25) |
| InChIKey | CJWGMSZWGKUSNZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |