About CID 174767435
CID 174767435 (PubChem CID 174767435) has the molecular formula C4H13AlO2P
and a molecular weight of 151.10 g/mol.
Molecular Properties
| Compound Name | CID 174767435 |
| PubChem CID | 174767435 |
| Molecular Formula | C4H13AlO2P |
| Molecular Weight | 151.10 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | — |
| SMILES | CCO[PH](=O)CC.[AlH2] |
| InChI | InChI=1S/C4H11O2P.Al.2H/c1-3-6-7(5)4-2;;;/h7H,3-4H2,1-2H3;;; |
| InChIKey | IKZMWPYFBIVBBW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174767435 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174767435?
The IUPAC name of CID 174767435 (CID 174767435) is not available.
What is the SMILES notation for CID 174767435?
The canonical SMILES for CID 174767435 is CCO[PH](=O)CC.[AlH2].
What is the InChIKey of CID 174767435?
The InChIKey is IKZMWPYFBIVBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O2P.Al.2H/c1-3-6-7(5)4-2;;;/h7H,3-4H2,1-2H3;;;.
What are the key properties of CID 174767435?
CID 174767435 has a molecular weight of 151.10 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174767435 is sourced from PubChem (CID 174767435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).