About copper;2,3-dinitroporphyrin
copper;2,3-dinitroporphyrin (PubChem CID 174767738) has the molecular formula C20H10CuN6O4
and a molecular weight of 461.88 g/mol. Its IUPAC name is copper;2,3-dinitroporphyrin.
Molecular Properties
| Compound Name | copper;2,3-dinitroporphyrin |
| PubChem CID | 174767738 |
| Molecular Formula | C20H10CuN6O4 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | copper;2,3-dinitroporphyrin |
| SMILES | O=[N+]([O-])C1=C([N+](=O)[O-])/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Cu] |
| InChI | InChI=1S/C20H10N6O4.Cu/c27-25(28)19-17-9-15-5-3-13(22-15)7-11-1-2-12(21-11)8-14-4-6-16(23-14)10-18(24-17)20(19)26(29)30;/h1-10H;/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-; |
| InChIKey | YOFUWCKLAHRPDF-RUBZYUMYSA-N |
| XLogP | 2.79 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;2,3-dinitroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2,3-dinitroporphyrin?
The IUPAC name of copper;2,3-dinitroporphyrin (CID 174767738) is copper;2,3-dinitroporphyrin.
What is the SMILES notation for copper;2,3-dinitroporphyrin?
The canonical SMILES for copper;2,3-dinitroporphyrin is O=[N+]([O-])C1=C([N+](=O)[O-])/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Cu].
What is the InChIKey of copper;2,3-dinitroporphyrin?
The InChIKey is YOFUWCKLAHRPDF-RUBZYUMYSA-N. The full InChI is InChI=1S/C20H10N6O4.Cu/c27-25(28)19-17-9-15-5-3-13(22-15)7-11-1-2-12(21-11)8-14-4-6-16(23-14)10-18(24-17)20(19)26(29)30;/h1-10H;/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-;.
What are the key properties of copper;2,3-dinitroporphyrin?
copper;2,3-dinitroporphyrin has a molecular weight of 461.88 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2,3-dinitroporphyrin is sourced from PubChem (CID 174767738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).