About (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate
(3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate (PubChem CID 174768180) has the molecular formula C18H21Cl2N5O3
and a molecular weight of 426.30 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate |
| PubChem CID | 174768180 |
| Molecular Formula | C18H21Cl2N5O3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate |
| SMILES | [H]/N=C(\CC(C)NC(=O)CCCc1cn[nH]n1)C(=O)OCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H21Cl2N5O3/c1-11(23-17(26)4-2-3-15-9-22-25-24-15)5-16(21)18(27)28-10-12-6-13(19)8-14(20)7-12/h6-9,11,21H,2-5,10H2,1H3,(H,23,26)(H,22,24,25)/b21-16+ |
| InChIKey | POXFMUDWIBZISQ-LTGZKZEYSA-N |
| XLogP | 3.09 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate?
The IUPAC name of (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate (CID 174768180) is (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate.
What is the SMILES notation for (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate?
The canonical SMILES for (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate is [H]/N=C(\CC(C)NC(=O)CCCc1cn[nH]n1)C(=O)OCc1cc(Cl)cc(Cl)c1.
What is the InChIKey of (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate?
The InChIKey is POXFMUDWIBZISQ-LTGZKZEYSA-N. The full InChI is InChI=1S/C18H21Cl2N5O3/c1-11(23-17(26)4-2-3-15-9-22-25-24-15)5-16(21)18(27)28-10-12-6-13(19)8-14(20)7-12/h6-9,11,21H,2-5,10H2,1H3,(H,23,26)(H,22,24,25)/b21-16+.
What are the key properties of (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate?
(3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate has a molecular weight of 426.30 g/mol, XLogP of 3.09, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)methyl 2-imino-4-[4-(2H-triazol-4-yl)butanoylamino]pentanoate is sourced from PubChem (CID 174768180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).