About 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole
1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole (PubChem CID 174768478) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole.
Molecular Properties
| Compound Name | 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole |
| PubChem CID | 174768478 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole |
| SMILES | COC1(n2ccnc2)C=CCC=C1 |
| InChI | InChI=1S/C10H12N2O/c1-13-10(5-3-2-4-6-10)12-8-7-11-9-12/h3-9H,2H2,1H3 |
| InChIKey | YVNQTRRKDVQOOH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole?
The IUPAC name of 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole (CID 174768478) is 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole.
What is the SMILES notation for 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole?
The canonical SMILES for 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole is COC1(n2ccnc2)C=CCC=C1.
What is the InChIKey of 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole?
The InChIKey is YVNQTRRKDVQOOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-13-10(5-3-2-4-6-10)12-8-7-11-9-12/h3-9H,2H2,1H3.
What are the key properties of 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole?
1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole has a molecular weight of 176.22 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxycyclohexa-2,5-dien-1-yl)imidazole is sourced from PubChem (CID 174768478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).