C12H16N2O — CID 174768591
1-(1-phenylmethoxyethyl)-4,5-dihydroimidazole (PubChem CID 174768591) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(1-phenylmethoxyethyl)-4,5-dihydroimidazole.
| Compound Name | 1-(1-phenylmethoxyethyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 174768591 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(1-phenylmethoxyethyl)-4,5-dihydroimidazole |
| SMILES | CC(OCc1ccccc1)N1C=NCC1 |
| InChI | InChI=1S/C12H16N2O/c1-11(14-8-7-13-10-14)15-9-12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3 |
| InChIKey | CRRXOGQULJSHAF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |