About bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole (PubChem CID 174768764) has the molecular formula C16H10FNOS
and a molecular weight of 283.33 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole |
| PubChem CID | 174768764 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole |
| SMILES | Fc1ccc(-c2nccs2)cc1.O=c1c2ccccc12 |
| InChI | InChI=1S/C9H6FNS.C7H4O/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;8-7-5-3-1-2-4-6(5)7/h1-6H;1-4H |
| InChIKey | QVIFMEURWHQBFV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole (CID 174768764) is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole is Fc1ccc(-c2nccs2)cc1.O=c1c2ccccc12.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole?
The InChIKey is QVIFMEURWHQBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNS.C7H4O/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;8-7-5-3-1-2-4-6(5)7/h1-6H;1-4H.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole?
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole has a molecular weight of 283.33 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;2-(4-fluorophenyl)-1,3-thiazole is sourced from PubChem (CID 174768764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).