About 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine
2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine (PubChem CID 174768802) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine.
Molecular Properties
| Compound Name | 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine |
| PubChem CID | 174768802 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine |
| SMILES | Fc1nccnc1N1C=CCC1 |
| InChI | InChI=1S/C8H8FN3/c9-7-8(11-4-3-10-7)12-5-1-2-6-12/h1,3-5H,2,6H2 |
| InChIKey | HOVHVHHKZWBJPD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine?
The IUPAC name of 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine (CID 174768802) is 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine.
What is the SMILES notation for 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine?
The canonical SMILES for 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine is Fc1nccnc1N1C=CCC1.
What is the InChIKey of 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine?
The InChIKey is HOVHVHHKZWBJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3/c9-7-8(11-4-3-10-7)12-5-1-2-6-12/h1,3-5H,2,6H2.
What are the key properties of 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine?
2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine has a molecular weight of 165.17 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydropyrrol-1-yl)-3-fluoropyrazine is sourced from PubChem (CID 174768802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).