About (4-acetyl-3-nitrophenyl) butaneperoxoate
(4-acetyl-3-nitrophenyl) butaneperoxoate (PubChem CID 174769094) has the molecular formula C12H13NO6
and a molecular weight of 267.24 g/mol. Its IUPAC name is (4-acetyl-3-nitrophenyl) butaneperoxoate.
Molecular Properties
| Compound Name | (4-acetyl-3-nitrophenyl) butaneperoxoate |
| PubChem CID | 174769094 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (4-acetyl-3-nitrophenyl) butaneperoxoate |
| SMILES | CCCC(=O)OOc1ccc(C(C)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13NO6/c1-3-4-12(15)19-18-9-5-6-10(8(2)14)11(7-9)13(16)17/h5-7H,3-4H2,1-2H3 |
| InChIKey | AVPJOOKYWZXNEM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyl-3-nitrophenyl) butaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-3-nitrophenyl) butaneperoxoate?
The IUPAC name of (4-acetyl-3-nitrophenyl) butaneperoxoate (CID 174769094) is (4-acetyl-3-nitrophenyl) butaneperoxoate.
What is the SMILES notation for (4-acetyl-3-nitrophenyl) butaneperoxoate?
The canonical SMILES for (4-acetyl-3-nitrophenyl) butaneperoxoate is CCCC(=O)OOc1ccc(C(C)=O)c([N+](=O)[O-])c1.
What is the InChIKey of (4-acetyl-3-nitrophenyl) butaneperoxoate?
The InChIKey is AVPJOOKYWZXNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO6/c1-3-4-12(15)19-18-9-5-6-10(8(2)14)11(7-9)13(16)17/h5-7H,3-4H2,1-2H3.
What are the key properties of (4-acetyl-3-nitrophenyl) butaneperoxoate?
(4-acetyl-3-nitrophenyl) butaneperoxoate has a molecular weight of 267.24 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-3-nitrophenyl) butaneperoxoate is sourced from PubChem (CID 174769094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).