About 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide
2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide (PubChem CID 174769294) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide |
| PubChem CID | 174769294 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide |
| SMILES | NC(=O)c1ccccc1C1=NCCO1 |
| InChI | InChI=1S/C10H10N2O2/c11-9(13)7-3-1-2-4-8(7)10-12-5-6-14-10/h1-4H,5-6H2,(H2,11,13) |
| InChIKey | BDEKSKLHYDHRHM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide?
The IUPAC name of 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide (CID 174769294) is 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide.
What is the SMILES notation for 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide?
The canonical SMILES for 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide is NC(=O)c1ccccc1C1=NCCO1.
What is the InChIKey of 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide?
The InChIKey is BDEKSKLHYDHRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-9(13)7-3-1-2-4-8(7)10-12-5-6-14-10/h1-4H,5-6H2,(H2,11,13).
What are the key properties of 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide?
2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide has a molecular weight of 190.20 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1,3-oxazol-2-yl)benzamide is sourced from PubChem (CID 174769294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).