About 1,1,1,3-tetrachloropropane;trichloroalumane
1,1,1,3-tetrachloropropane;trichloroalumane (PubChem CID 174769747) has the molecular formula C3H4AlCl7
and a molecular weight of 315.22 g/mol. Its IUPAC name is 1,1,1,3-tetrachloropropane;trichloroalumane.
Molecular Properties
| Compound Name | 1,1,1,3-tetrachloropropane;trichloroalumane |
| PubChem CID | 174769747 |
| Molecular Formula | C3H4AlCl7 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 311.79 |
| IUPAC Name | 1,1,1,3-tetrachloropropane;trichloroalumane |
| SMILES | ClCCC(Cl)(Cl)Cl.Cl[Al](Cl)Cl |
| InChI | InChI=1S/C3H4Cl4.Al.3ClH/c4-2-1-3(5,6)7;;;;/h1-2H2;;3*1H/q;+3;;;/p-3 |
| InChIKey | LMBPVXNXIMWHIW-UHFFFAOYSA-K |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1,3-tetrachloropropane;trichloroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1,3-tetrachloropropane;trichloroalumane?
The IUPAC name of 1,1,1,3-tetrachloropropane;trichloroalumane (CID 174769747) is 1,1,1,3-tetrachloropropane;trichloroalumane.
What is the SMILES notation for 1,1,1,3-tetrachloropropane;trichloroalumane?
The canonical SMILES for 1,1,1,3-tetrachloropropane;trichloroalumane is ClCCC(Cl)(Cl)Cl.Cl[Al](Cl)Cl.
What is the InChIKey of 1,1,1,3-tetrachloropropane;trichloroalumane?
The InChIKey is LMBPVXNXIMWHIW-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H4Cl4.Al.3ClH/c4-2-1-3(5,6)7;;;;/h1-2H2;;3*1H/q;+3;;;/p-3.
What are the key properties of 1,1,1,3-tetrachloropropane;trichloroalumane?
1,1,1,3-tetrachloropropane;trichloroalumane has a molecular weight of 315.22 g/mol, XLogP of 4.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1,3-tetrachloropropane;trichloroalumane is sourced from PubChem (CID 174769747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).