C10H10F3NO2 — CID 174769913
butanoic acid;2,3,4-trifluoro-6-azabicyclo[3.1.1]hepta-1(7),2,4-triene (PubChem CID 174769913) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is butanoic acid;2,3,4-trifluoro-6-azabicyclo[3.1.1]hepta-1(7),2,4-triene.
| Compound Name | butanoic acid;2,3,4-trifluoro-6-azabicyclo[3.1.1]hepta-1(7),2,4-triene |
|---|---|
| PubChem CID | 174769913 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | butanoic acid;2,3,4-trifluoro-6-azabicyclo[3.1.1]hepta-1(7),2,4-triene |
| SMILES | CCCC(=O)O.Fc1c2cc(c(F)c1F)N2 |
| InChI | InChI=1S/C6H2F3N.C4H8O2/c7-4-2-1-3(10-2)5(8)6(4)9;1-2-3-4(5)6/h1,10H;2-3H2,1H3,(H,5,6) |
| InChIKey | SQKUWWOGCJPBGA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|