About 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc
21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc (PubChem CID 174770463) has the molecular formula C20H14N4SSmZn
and a molecular weight of 558.18 g/mol. Its IUPAC name is 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc.
Molecular Properties
| Compound Name | 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc |
| PubChem CID | 174770463 |
| Molecular Formula | C20H14N4SSmZn |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 557.94 |
| IUPAC Name | 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc |
| SMILES | S=C1C=C2C=c3ccc([nH]3)=CC3=NC(=CC4=NC(=CC1N2)C=C4)C=C3.[Sm].[Zn] |
| InChI | InChI=1S/C20H14N4S.Sm.Zn/c25-20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18;;/h1-11,19,22,24H;; |
| InChIKey | RYISDZDMJNAUOF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc?
The IUPAC name of 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc (CID 174770463) is 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc.
What is the SMILES notation for 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc?
The canonical SMILES for 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc is S=C1C=C2C=c3ccc([nH]3)=CC3=NC(=CC4=NC(=CC1N2)C=C4)C=C3.[Sm].[Zn].
What is the InChIKey of 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc?
The InChIKey is RYISDZDMJNAUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4S.Sm.Zn/c25-20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18;;/h1-11,19,22,24H;;.
What are the key properties of 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc?
21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc has a molecular weight of 558.18 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22-dihydro-1H-porphyrin-2-thione;samarium;zinc is sourced from PubChem (CID 174770463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).