C14H8N2O2S — CID 174770480
2-(1-benzothiophen-2-yl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 174770480) has the molecular formula C14H8N2O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2-(1-benzothiophen-2-yl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 174770480 |
| Molecular Formula | C14H8N2O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2cc(-c3cc4ccccc4s3)[nH]c2C1=O |
| InChI | InChI=1S/C14H8N2O2S/c17-13-12-9(16-14(13)18)6-8(15-12)11-5-7-3-1-2-4-10(7)19-11/h1-6,15H,(H,16,17,18) |
| InChIKey | PZOJWMFCLIPEKM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|