C49H44F8N6O — CID 174770612
bis[4-(4-fluorophenyl)-3-[4-[2-methyl-5-(trifluoromethyl)anilino]-3-pyridinyl]piperidin-1-yl]methanone (PubChem CID 174770612) has the molecular formula C49H44F8N6O and a molecular weight of 884.92 g/mol. Its IUPAC name is bis[4-(4-fluorophenyl)-3-[4-[2-methyl-5-(trifluoromethyl)anilino]-3-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | bis[4-(4-fluorophenyl)-3-[4-[2-methyl-5-(trifluoromethyl)anilino]-3-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 174770612 |
| Molecular Formula | C49H44F8N6O |
| Molecular Weight | 884.92 g/mol |
| Exact Mass | 884.34 |
| IUPAC Name | bis[4-(4-fluorophenyl)-3-[4-[2-methyl-5-(trifluoromethyl)anilino]-3-pyridinyl]piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(F)(F)F)cc1Nc1ccncc1C1CN(C(=O)N2CCC(c3ccc(F)cc3)C(c3cnccc3Nc3cc(C(F)(F)F)ccc3C)C2)CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C49H44F8N6O/c1-29-3-9-33(48(52,53)54)23-45(29)60-43-15-19-58-25-39(43)41-27-62(21-17-37(41)31-5-11-35(50)12-6-31)47(64)63-22-18-38(32-7-13-36(51)14-8-32)42(28-63)40-26-59-20-16-44(40)61-46-24-34(49(55,56)57)10-4-30(46)2/h3-16,19-20,23-26,37-38,41-42H,17-18,21-22,27-28H2,1-2H3,(H,58,60)(H,59,61) |
| InChIKey | ZMQZHGJYKVMSJC-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.92 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |