C15H18O — CID 174770892
1,2,3,4-tetramethyl-8aH-naphthalene-1-carbaldehyde (PubChem CID 174770892) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-8aH-naphthalene-1-carbaldehyde.
| Compound Name | 1,2,3,4-tetramethyl-8aH-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 174770892 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1,2,3,4-tetramethyl-8aH-naphthalene-1-carbaldehyde |
| SMILES | CC1=C2C=CC=CC2C(C)(C=O)C(C)=C1C |
| InChI | InChI=1S/C15H18O/c1-10-11(2)13-7-5-6-8-14(13)15(4,9-16)12(10)3/h5-9,14H,1-4H3 |
| InChIKey | JCMSWXBEVXVQPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|