C12H10Br2N2O2S — CID 17477090
2-(2,4-dibromophenoxy)-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 17477090) has the molecular formula C12H10Br2N2O2S and a molecular weight of 406.10 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17477090 |
| Molecular Formula | C12H10Br2N2O2S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)COc2ccc(Br)cc2Br)s1 |
| InChI | InChI=1S/C12H10Br2N2O2S/c1-7-5-15-12(19-7)16-11(17)6-18-10-3-2-8(13)4-9(10)14/h2-5H,6H2,1H3,(H,15,16,17) |
| InChIKey | IVKYOOCTXZRSBL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |