About 2-amino-3-chlorophenol;4-aminophenol
2-amino-3-chlorophenol;4-aminophenol (PubChem CID 174770945) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-amino-3-chlorophenol;4-aminophenol.
Molecular Properties
| Compound Name | 2-amino-3-chlorophenol;4-aminophenol |
| PubChem CID | 174770945 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-amino-3-chlorophenol;4-aminophenol |
| SMILES | Nc1c(O)cccc1Cl.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6ClNO.C6H7NO/c7-4-2-1-3-5(9)6(4)8;7-5-1-3-6(8)4-2-5/h1-3,9H,8H2;1-4,8H,7H2 |
| InChIKey | OWGZYKGIQNWAFI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-chlorophenol;4-aminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-chlorophenol;4-aminophenol?
The IUPAC name of 2-amino-3-chlorophenol;4-aminophenol (CID 174770945) is 2-amino-3-chlorophenol;4-aminophenol.
What is the SMILES notation for 2-amino-3-chlorophenol;4-aminophenol?
The canonical SMILES for 2-amino-3-chlorophenol;4-aminophenol is Nc1c(O)cccc1Cl.Nc1ccc(O)cc1.
What is the InChIKey of 2-amino-3-chlorophenol;4-aminophenol?
The InChIKey is OWGZYKGIQNWAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO.C6H7NO/c7-4-2-1-3-5(9)6(4)8;7-5-1-3-6(8)4-2-5/h1-3,9H,8H2;1-4,8H,7H2.
What are the key properties of 2-amino-3-chlorophenol;4-aminophenol?
2-amino-3-chlorophenol;4-aminophenol has a molecular weight of 252.70 g/mol, XLogP of 2.60, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-chlorophenol;4-aminophenol is sourced from PubChem (CID 174770945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).