About [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate
[1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate (PubChem CID 174771297) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate.
Molecular Properties
| Compound Name | [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate |
| PubChem CID | 174771297 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate |
| SMILES | CNC1CC(C2(COC(N)=O)C=CC=CC2)C1 |
| InChI | InChI=1S/C13H20N2O2/c1-15-11-7-10(8-11)13(9-17-12(14)16)5-3-2-4-6-13/h2-5,10-11,15H,6-9H2,1H3,(H2,14,16) |
| InChIKey | LPWNXTDUHXKAKW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate?
The IUPAC name of [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate (CID 174771297) is [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate.
What is the SMILES notation for [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate?
The canonical SMILES for [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate is CNC1CC(C2(COC(N)=O)C=CC=CC2)C1.
What is the InChIKey of [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate?
The InChIKey is LPWNXTDUHXKAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-15-11-7-10(8-11)13(9-17-12(14)16)5-3-2-4-6-13/h2-5,10-11,15H,6-9H2,1H3,(H2,14,16).
What are the key properties of [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate?
[1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate has a molecular weight of 236.31 g/mol, XLogP of 1.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(methylamino)cyclobutyl]cyclohexa-2,4-dien-1-yl]methyl carbamate is sourced from PubChem (CID 174771297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).