About piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride
piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride (PubChem CID 174771610) has the molecular formula C7H13ClF3N5
and a molecular weight of 259.66 g/mol. Its IUPAC name is piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride.
Molecular Properties
| Compound Name | piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride |
| PubChem CID | 174771610 |
| Molecular Formula | C7H13ClF3N5 |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride |
| SMILES | C1CNCCN1.Cl.FC(F)(F)c1cn[nH]n1 |
| InChI | InChI=1S/C4H10N2.C3H2F3N3.ClH/c1-2-6-4-3-5-1;4-3(5,6)2-1-7-9-8-2;/h5-6H,1-4H2;1H,(H,7,8,9);1H |
| InChIKey | ALMLWYWEBSFMCB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride?
The IUPAC name of piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride (CID 174771610) is piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride.
What is the SMILES notation for piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride?
The canonical SMILES for piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride is C1CNCCN1.Cl.FC(F)(F)c1cn[nH]n1.
What is the InChIKey of piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride?
The InChIKey is ALMLWYWEBSFMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C3H2F3N3.ClH/c1-2-6-4-3-5-1;4-3(5,6)2-1-7-9-8-2;/h5-6H,1-4H2;1H,(H,7,8,9);1H.
What are the key properties of piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride?
piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride has a molecular weight of 259.66 g/mol, XLogP of 0.42, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;4-(trifluoromethyl)-2H-triazole;hydrochloride is sourced from PubChem (CID 174771610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).