About 3-(dimethylamino)benzoic acid;1H-pyrrole
3-(dimethylamino)benzoic acid;1H-pyrrole (PubChem CID 174771753) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(dimethylamino)benzoic acid;1H-pyrrole.
Molecular Properties
| Compound Name | 3-(dimethylamino)benzoic acid;1H-pyrrole |
| PubChem CID | 174771753 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(dimethylamino)benzoic acid;1H-pyrrole |
| SMILES | CN(C)c1cccc(C(=O)O)c1.c1cc[nH]c1 |
| InChI | InChI=1S/C9H11NO2.C4H5N/c1-10(2)8-5-3-4-7(6-8)9(11)12;1-2-4-5-3-1/h3-6H,1-2H3,(H,11,12);1-5H |
| InChIKey | KOPYMZSUCMQKNQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dimethylamino)benzoic acid;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)benzoic acid;1H-pyrrole?
The IUPAC name of 3-(dimethylamino)benzoic acid;1H-pyrrole (CID 174771753) is 3-(dimethylamino)benzoic acid;1H-pyrrole.
What is the SMILES notation for 3-(dimethylamino)benzoic acid;1H-pyrrole?
The canonical SMILES for 3-(dimethylamino)benzoic acid;1H-pyrrole is CN(C)c1cccc(C(=O)O)c1.c1cc[nH]c1.
What is the InChIKey of 3-(dimethylamino)benzoic acid;1H-pyrrole?
The InChIKey is KOPYMZSUCMQKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C4H5N/c1-10(2)8-5-3-4-7(6-8)9(11)12;1-2-4-5-3-1/h3-6H,1-2H3,(H,11,12);1-5H.
What are the key properties of 3-(dimethylamino)benzoic acid;1H-pyrrole?
3-(dimethylamino)benzoic acid;1H-pyrrole has a molecular weight of 232.28 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)benzoic acid;1H-pyrrole is sourced from PubChem (CID 174771753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).