About 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide
1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide (PubChem CID 174772123) has the molecular formula C11H16BrN
and a molecular weight of 242.16 g/mol. Its IUPAC name is 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide.
Molecular Properties
| Compound Name | 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide |
| PubChem CID | 174772123 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide |
| SMILES | Br.C=CCC1C=CC=CN1CC=C |
| InChI | InChI=1S/C11H15N.BrH/c1-3-7-11-8-5-6-10-12(11)9-4-2;/h3-6,8,10-11H,1-2,7,9H2;1H |
| InChIKey | WSNVUYSMCLXMTR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide?
The IUPAC name of 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide (CID 174772123) is 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide.
What is the SMILES notation for 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide?
The canonical SMILES for 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide is Br.C=CCC1C=CC=CN1CC=C.
What is the InChIKey of 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide?
The InChIKey is WSNVUYSMCLXMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.BrH/c1-3-7-11-8-5-6-10-12(11)9-4-2;/h3-6,8,10-11H,1-2,7,9H2;1H.
What are the key properties of 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide?
1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide has a molecular weight of 242.16 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(prop-2-enyl)-2H-pyridine;hydrobromide is sourced from PubChem (CID 174772123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).