About 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione
4,8-diethyl-4,8-dihydronaphthalene-1,5-dione (PubChem CID 174772232) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione.
Molecular Properties
| Compound Name | 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione |
| PubChem CID | 174772232 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione |
| SMILES | CCC1C=CC(=O)C2=C1C(=O)C=CC2CC |
| InChI | InChI=1S/C14H16O2/c1-3-9-5-7-12(16)14-10(4-2)6-8-11(15)13(9)14/h5-10H,3-4H2,1-2H3 |
| InChIKey | MRZFLQRJWIIYSQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione?
The IUPAC name of 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione (CID 174772232) is 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione.
What is the SMILES notation for 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione?
The canonical SMILES for 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione is CCC1C=CC(=O)C2=C1C(=O)C=CC2CC.
What is the InChIKey of 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione?
The InChIKey is MRZFLQRJWIIYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-3-9-5-7-12(16)14-10(4-2)6-8-11(15)13(9)14/h5-10H,3-4H2,1-2H3.
What are the key properties of 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione?
4,8-diethyl-4,8-dihydronaphthalene-1,5-dione has a molecular weight of 216.28 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-diethyl-4,8-dihydronaphthalene-1,5-dione is sourced from PubChem (CID 174772232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).