About 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde
6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde (PubChem CID 174772296) has the molecular formula C15H20N2O5
and a molecular weight of 308.33 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde.
Molecular Properties
| Compound Name | 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde |
| PubChem CID | 174772296 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde |
| SMILES | COCCOc1cc2c(cc1OCCOC)C(C=O)N=CN2 |
| InChI | InChI=1S/C15H20N2O5/c1-19-3-5-21-14-7-11-12(16-10-17-13(11)9-18)8-15(14)22-6-4-20-2/h7-10,13H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | LTBWEDZFCHLSCM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde?
The IUPAC name of 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde (CID 174772296) is 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde.
What is the SMILES notation for 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde?
The canonical SMILES for 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde is COCCOc1cc2c(cc1OCCOC)C(C=O)N=CN2.
What is the InChIKey of 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde?
The InChIKey is LTBWEDZFCHLSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O5/c1-19-3-5-21-14-7-11-12(16-10-17-13(11)9-18)8-15(14)22-6-4-20-2/h7-10,13H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde?
6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde has a molecular weight of 308.33 g/mol, XLogP of 1.43, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(2-methoxyethoxy)-1,4-dihydroquinazoline-4-carbaldehyde is sourced from PubChem (CID 174772296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).