About (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde
(5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174773838) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
| PubChem CID | 174773838 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1NC[C@H](CO)O1 |
| InChI | InChI=1S/C5H9NO3/c7-2-4-1-6-5(3-8)9-4/h3-7H,1-2H2/t4-,5?/m1/s1 |
| InChIKey | DQOAYDBDICBYIN-CNZKWPKMSA-N |
| XLogP | -1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde?
The IUPAC name of (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde (CID 174773838) is (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde.
What is the SMILES notation for (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde?
The canonical SMILES for (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde is O=CC1NC[C@H](CO)O1.
What is the InChIKey of (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde?
The InChIKey is DQOAYDBDICBYIN-CNZKWPKMSA-N. The full InChI is InChI=1S/C5H9NO3/c7-2-4-1-6-5(3-8)9-4/h3-7H,1-2H2/t4-,5?/m1/s1.
What are the key properties of (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde?
(5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde has a molecular weight of 131.13 g/mol, XLogP of -1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde is sourced from PubChem (CID 174773838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).