About 2-methylpropan-1-ol;oxiran-2-ylmethanol
2-methylpropan-1-ol;oxiran-2-ylmethanol (PubChem CID 174774669) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-methylpropan-1-ol;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;oxiran-2-ylmethanol |
| PubChem CID | 174774669 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 2-methylpropan-1-ol;oxiran-2-ylmethanol |
| SMILES | CC(C)CO.OCC1CO1 |
| InChI | InChI=1S/C4H10O.C3H6O2/c1-4(2)3-5;4-1-3-2-5-3/h4-5H,3H2,1-2H3;3-4H,1-2H2 |
| InChIKey | RKURKCTUUUHRKL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-1-ol;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;oxiran-2-ylmethanol?
The IUPAC name of 2-methylpropan-1-ol;oxiran-2-ylmethanol (CID 174774669) is 2-methylpropan-1-ol;oxiran-2-ylmethanol.
What is the SMILES notation for 2-methylpropan-1-ol;oxiran-2-ylmethanol?
The canonical SMILES for 2-methylpropan-1-ol;oxiran-2-ylmethanol is CC(C)CO.OCC1CO1.
What is the InChIKey of 2-methylpropan-1-ol;oxiran-2-ylmethanol?
The InChIKey is RKURKCTUUUHRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C3H6O2/c1-4(2)3-5;4-1-3-2-5-3/h4-5H,3H2,1-2H3;3-4H,1-2H2.
What are the key properties of 2-methylpropan-1-ol;oxiran-2-ylmethanol?
2-methylpropan-1-ol;oxiran-2-ylmethanol has a molecular weight of 148.20 g/mol, XLogP of 0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;oxiran-2-ylmethanol is sourced from PubChem (CID 174774669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).