C12H10BrNO3 — CID 174775458
4-bromo-2-hydroxy-3a,4,5,6-tetrahydrobenzo[de]isoquinoline-1,3-dione (PubChem CID 174775458) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 4-bromo-2-hydroxy-3a,4,5,6-tetrahydrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 4-bromo-2-hydroxy-3a,4,5,6-tetrahydrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 174775458 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 4-bromo-2-hydroxy-3a,4,5,6-tetrahydrobenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c2C(C(=O)N1O)C(Br)CC3 |
| InChI | InChI=1S/C12H10BrNO3/c13-8-5-4-6-2-1-3-7-9(6)10(8)12(16)14(17)11(7)15/h1-3,8,10,17H,4-5H2 |
| InChIKey | TUPUMCVDYFAAJW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|