About 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine
6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine (PubChem CID 174775794) has the molecular formula C15H18ClN5
and a molecular weight of 303.80 g/mol. Its IUPAC name is 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine |
| PubChem CID | 174775794 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine |
| SMILES | NCc1ccc(Cl)cc1-c1cc(NC2CCC2)nc(N)n1 |
| InChI | InChI=1S/C15H18ClN5/c16-10-5-4-9(8-17)12(6-10)13-7-14(21-15(18)20-13)19-11-2-1-3-11/h4-7,11H,1-3,8,17H2,(H3,18,19,20,21) |
| InChIKey | ZMBYCVCUBXLVEX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine?
The IUPAC name of 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine (CID 174775794) is 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine?
The canonical SMILES for 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine is NCc1ccc(Cl)cc1-c1cc(NC2CCC2)nc(N)n1.
What is the InChIKey of 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine?
The InChIKey is ZMBYCVCUBXLVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN5/c16-10-5-4-9(8-17)12(6-10)13-7-14(21-15(18)20-13)19-11-2-1-3-11/h4-7,11H,1-3,8,17H2,(H3,18,19,20,21).
What are the key properties of 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine?
6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine has a molecular weight of 303.80 g/mol, XLogP of 2.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(aminomethyl)-5-chlorophenyl]-4-N-cyclobutylpyrimidine-2,4-diamine is sourced from PubChem (CID 174775794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).