C11H18INO2 — CID 174775829
1-(1,1-dimethoxybutyl)pyridin-1-ium iodide (PubChem CID 174775829) has the molecular formula C11H18INO2 and a molecular weight of 323.17 g/mol. Its IUPAC name is 1-(1,1-dimethoxybutyl)pyridin-1-ium iodide.
| Compound Name | 1-(1,1-dimethoxybutyl)pyridin-1-ium iodide |
|---|---|
| PubChem CID | 174775829 |
| Molecular Formula | C11H18INO2 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(1,1-dimethoxybutyl)pyridin-1-ium iodide |
| SMILES | CCCC(OC)(OC)[n+]1ccccc1.[I-] |
| InChI | InChI=1S/C11H18NO2.HI/c1-4-8-11(13-2,14-3)12-9-6-5-7-10-12;/h5-7,9-10H,4,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QTTOFBAKARZYRK-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|