C3H6MgN8O6 — CID 174776136
magnesium;1,3,5-triazine-2,4,6-triamine;dinitrate (PubChem CID 174776136) has the molecular formula C3H6MgN8O6 and a molecular weight of 274.44 g/mol. Its IUPAC name is magnesium;1,3,5-triazine-2,4,6-triamine;dinitrate.
| Compound Name | magnesium;1,3,5-triazine-2,4,6-triamine;dinitrate |
|---|---|
| PubChem CID | 174776136 |
| Molecular Formula | C3H6MgN8O6 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | magnesium;1,3,5-triazine-2,4,6-triamine;dinitrate |
| SMILES | Nc1nc(N)nc(N)n1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C3H6N6.Mg.2NO3/c4-1-7-2(5)9-3(6)8-1;;2*2-1(3)4/h(H6,4,5,6,7,8,9);;;/q;+2;2*-1 |
| InChIKey | CBMJIZMIFZTHDL-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 249.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|