About (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate
(2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate (PubChem CID 174776286) has the molecular formula C13H13N3O2S
and a molecular weight of 275.33 g/mol. Its IUPAC name is (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate.
Molecular Properties
| Compound Name | (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
| PubChem CID | 174776286 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
| SMILES | CSc1ncc2c(n1)-c1[nH]cc(OC(C)=O)c1CC2 |
| InChI | InChI=1S/C13H13N3O2S/c1-7(17)18-10-6-14-12-9(10)4-3-8-5-15-13(19-2)16-11(8)12/h5-6,14H,3-4H2,1-2H3 |
| InChIKey | VYZWZHBCPUNGMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The IUPAC name of (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate (CID 174776286) is (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate.
What is the SMILES notation for (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The canonical SMILES for (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate is CSc1ncc2c(n1)-c1[nH]cc(OC(C)=O)c1CC2.
What is the InChIKey of (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The InChIKey is VYZWZHBCPUNGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2S/c1-7(17)18-10-6-14-12-9(10)4-3-8-5-15-13(19-2)16-11(8)12/h5-6,14H,3-4H2,1-2H3.
What are the key properties of (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
(2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate has a molecular weight of 275.33 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanyl-6,9-dihydro-5H-pyrrolo[3,2-h]quinazolin-7-yl) acetate is sourced from PubChem (CID 174776286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).