About (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride
(2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride (PubChem CID 174776362) has the molecular formula C18H23ClN4O2S
and a molecular weight of 394.93 g/mol. Its IUPAC name is (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride.
Molecular Properties
| Compound Name | (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride |
| PubChem CID | 174776362 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride |
| SMILES | CSc1ncc2c(n1)-c1c(c(OC(C)=O)cn1C1CCNCC1)CC2.Cl |
| InChI | InChI=1S/C18H22N4O2S.ClH/c1-11(23)24-15-10-22(13-5-7-19-8-6-13)17-14(15)4-3-12-9-20-18(25-2)21-16(12)17;/h9-10,13,19H,3-8H2,1-2H3;1H |
| InChIKey | MBDGSQJVVHTGGU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride?
The IUPAC name of (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride (CID 174776362) is (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride.
What is the SMILES notation for (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride?
The canonical SMILES for (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride is CSc1ncc2c(n1)-c1c(c(OC(C)=O)cn1C1CCNCC1)CC2.Cl.
What is the InChIKey of (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride?
The InChIKey is MBDGSQJVVHTGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2S.ClH/c1-11(23)24-15-10-22(13-5-7-19-8-6-13)17-14(15)4-3-12-9-20-18(25-2)21-16(12)17;/h9-10,13,19H,3-8H2,1-2H3;1H.
What are the key properties of (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride?
(2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride has a molecular weight of 394.93 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanyl-9-piperidin-4-yl-5,6-dihydropyrrolo[3,2-h]quinazolin-7-yl) acetate;hydrochloride is sourced from PubChem (CID 174776362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).