C11H16N4O6 — CID 174776645
2-methoxy-7H-purine;2,3,4,5-tetrahydroxypentanal (PubChem CID 174776645) has the molecular formula C11H16N4O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-methoxy-7H-purine;2,3,4,5-tetrahydroxypentanal.
| Compound Name | 2-methoxy-7H-purine;2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 174776645 |
| Molecular Formula | C11H16N4O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-methoxy-7H-purine;2,3,4,5-tetrahydroxypentanal |
| SMILES | COc1ncc2[nH]cnc2n1.O=CC(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H6N4O.C5H10O5/c1-11-6-7-2-4-5(10-6)9-3-8-4;6-1-3(8)5(10)4(9)2-7/h2-3H,1H3,(H,7,8,9,10);1,3-5,7-10H,2H2 |
| InChIKey | YGMZEFLJXNAJEE-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|