About 9-iodo-3H-xanthene
9-iodo-3H-xanthene (PubChem CID 174776721) has the molecular formula C13H9IO
and a molecular weight of 308.12 g/mol. Its IUPAC name is 9-iodo-3H-xanthene.
Molecular Properties
| Compound Name | 9-iodo-3H-xanthene |
| PubChem CID | 174776721 |
| Molecular Formula | C13H9IO |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 9-iodo-3H-xanthene |
| SMILES | IC1=C2C=CCC=C2Oc2ccccc21 |
| InChI | InChI=1S/C13H9IO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-3,5-8H,4H2 |
| InChIKey | AGDTWKJNUTXOKO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-3H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-3H-xanthene?
The IUPAC name of 9-iodo-3H-xanthene (CID 174776721) is 9-iodo-3H-xanthene.
What is the SMILES notation for 9-iodo-3H-xanthene?
The canonical SMILES for 9-iodo-3H-xanthene is IC1=C2C=CCC=C2Oc2ccccc21.
What is the InChIKey of 9-iodo-3H-xanthene?
The InChIKey is AGDTWKJNUTXOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9IO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-3,5-8H,4H2.
What are the key properties of 9-iodo-3H-xanthene?
9-iodo-3H-xanthene has a molecular weight of 308.12 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-3H-xanthene is sourced from PubChem (CID 174776721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).