About ethoxyethane;sulfuryl diazide
ethoxyethane;sulfuryl diazide (PubChem CID 174776903) has the molecular formula C4H10N6O3S
and a molecular weight of 222.23 g/mol. Its IUPAC name is ethoxyethane;sulfuryl diazide.
Molecular Properties
| Compound Name | ethoxyethane;sulfuryl diazide |
| PubChem CID | 174776903 |
| Molecular Formula | C4H10N6O3S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | ethoxyethane;sulfuryl diazide |
| SMILES | CCOCC.[N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C4H10O.N6O2S/c1-3-5-4-2;1-3-5-9(7,8)6-4-2/h3-4H2,1-2H3; |
| InChIKey | DQGREZOVYZHVGA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 140.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;sulfuryl diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;sulfuryl diazide?
The IUPAC name of ethoxyethane;sulfuryl diazide (CID 174776903) is ethoxyethane;sulfuryl diazide.
What is the SMILES notation for ethoxyethane;sulfuryl diazide?
The canonical SMILES for ethoxyethane;sulfuryl diazide is CCOCC.[N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].
What is the InChIKey of ethoxyethane;sulfuryl diazide?
The InChIKey is DQGREZOVYZHVGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.N6O2S/c1-3-5-4-2;1-3-5-9(7,8)6-4-2/h3-4H2,1-2H3;.
What are the key properties of ethoxyethane;sulfuryl diazide?
ethoxyethane;sulfuryl diazide has a molecular weight of 222.23 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;sulfuryl diazide is sourced from PubChem (CID 174776903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).