About butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate
butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate (PubChem CID 174777421) has the molecular formula C15H20FNO3
and a molecular weight of 281.33 g/mol. Its IUPAC name is butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate.
Molecular Properties
| Compound Name | butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate |
| PubChem CID | 174777421 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate |
| SMILES | CCCCOC(=O)O[C@@H]1CNC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FNO3/c1-2-3-8-19-15(18)20-14-10-17-9-13(14)11-4-6-12(16)7-5-11/h4-7,13-14,17H,2-3,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | MIXCGYNHFVAGEO-UONOGXRCSA-N |
| XLogP | 2.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate?
The IUPAC name of butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate (CID 174777421) is butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate.
What is the SMILES notation for butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate?
The canonical SMILES for butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate is CCCCOC(=O)O[C@@H]1CNC[C@H]1c1ccc(F)cc1.
What is the InChIKey of butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate?
The InChIKey is MIXCGYNHFVAGEO-UONOGXRCSA-N. The full InChI is InChI=1S/C15H20FNO3/c1-2-3-8-19-15(18)20-14-10-17-9-13(14)11-4-6-12(16)7-5-11/h4-7,13-14,17H,2-3,8-10H2,1H3/t13-,14+/m0/s1.
What are the key properties of butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate?
butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate has a molecular weight of 281.33 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl [(3S,4R)-4-(4-fluorophenyl)pyrrolidin-3-yl] carbonate is sourced from PubChem (CID 174777421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).