About CID 174778144
CID 174778144 (PubChem CID 174778144) has the molecular formula HF6PTl
and a molecular weight of 350.35 g/mol.
Molecular Properties
| Compound Name | CID 174778144 |
| PubChem CID | 174778144 |
| Molecular Formula | HF6PTl |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | — |
| SMILES | F[P-](F)(F)(F)(F)F.[H+].[Tl] |
| InChI | InChI=1S/F6P.Tl/c1-7(2,3,4,5)6;/q-1;/p+1 |
| InChIKey | DUIIMMXHZDWTHE-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174778144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174778144?
The IUPAC name of CID 174778144 (CID 174778144) is not available.
What is the SMILES notation for CID 174778144?
The canonical SMILES for CID 174778144 is F[P-](F)(F)(F)(F)F.[H+].[Tl].
What is the InChIKey of CID 174778144?
The InChIKey is DUIIMMXHZDWTHE-UHFFFAOYSA-O. The full InChI is InChI=1S/F6P.Tl/c1-7(2,3,4,5)6;/q-1;/p+1.
What are the key properties of CID 174778144?
CID 174778144 has a molecular weight of 350.35 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174778144 is sourced from PubChem (CID 174778144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).